C20H20F3N5O — CID 46438173
N-[3-(N-methylanilino)propyl]-1-[2-(trifluoromethyl)phenyl]triazole-4-carboxamide (PubChem CID 46438173) has the molecular formula C20H20F3N5O and a molecular weight of 403.41 g/mol. Its IUPAC name is N-[3-(N-methylanilino)propyl]-1-[2-(trifluoromethyl)phenyl]triazole-4-carboxamide.
| Compound Name | N-[3-(N-methylanilino)propyl]-1-[2-(trifluoromethyl)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 46438173 |
| Molecular Formula | C20H20F3N5O |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | N-[3-(N-methylanilino)propyl]-1-[2-(trifluoromethyl)phenyl]triazole-4-carboxamide |
| SMILES | CN(CCCNC(=O)c1cn(-c2ccccc2C(F)(F)F)nn1)c1ccccc1 |
| InChI | InChI=1S/C20H20F3N5O/c1-27(15-8-3-2-4-9-15)13-7-12-24-19(29)17-14-28(26-25-17)18-11-6-5-10-16(18)20(21,22)23/h2-6,8-11,14H,7,12-13H2,1H3,(H,24,29) |
| InChIKey | RIFUVHFLQFPZCA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|