C19H30Cl2N6O — CID 119861961
N-[4-(N-methylanilino)butyl]-1-piperidin-4-yltriazole-4-carboxamide;dihydrochloride (PubChem CID 119861961) has the molecular formula C19H30Cl2N6O and a molecular weight of 429.40 g/mol. Its IUPAC name is N-[4-(N-methylanilino)butyl]-1-piperidin-4-yltriazole-4-carboxamide;dihydrochloride.
| Compound Name | N-[4-(N-methylanilino)butyl]-1-piperidin-4-yltriazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119861961 |
| Molecular Formula | C19H30Cl2N6O |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | N-[4-(N-methylanilino)butyl]-1-piperidin-4-yltriazole-4-carboxamide;dihydrochloride |
| SMILES | CN(CCCCNC(=O)c1cn(C2CCNCC2)nn1)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C19H28N6O.2ClH/c1-24(16-7-3-2-4-8-16)14-6-5-11-21-19(26)18-15-25(23-22-18)17-9-12-20-13-10-17;;/h2-4,7-8,15,17,20H,5-6,9-14H2,1H3,(H,21,26);2*1H |
| InChIKey | HVNCJDFTHMYPPO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|