C21H18F3N5O2 — CID 30886994
N-[3-(pyrrolidine-1-carbonyl)phenyl]-1-[2-(trifluoromethyl)phenyl]triazole-4-carboxamide (PubChem CID 30886994) has the molecular formula C21H18F3N5O2 and a molecular weight of 429.40 g/mol. Its IUPAC name is N-[3-(pyrrolidine-1-carbonyl)phenyl]-1-[2-(trifluoromethyl)phenyl]triazole-4-carboxamide.
| Compound Name | N-[3-(pyrrolidine-1-carbonyl)phenyl]-1-[2-(trifluoromethyl)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 30886994 |
| Molecular Formula | C21H18F3N5O2 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | N-[3-(pyrrolidine-1-carbonyl)phenyl]-1-[2-(trifluoromethyl)phenyl]triazole-4-carboxamide |
| SMILES | O=C(Nc1cccc(C(=O)N2CCCC2)c1)c1cn(-c2ccccc2C(F)(F)F)nn1 |
| InChI | InChI=1S/C21H18F3N5O2/c22-21(23,24)16-8-1-2-9-18(16)29-13-17(26-27-29)19(30)25-15-7-5-6-14(12-15)20(31)28-10-3-4-11-28/h1-2,5-9,12-13H,3-4,10-11H2,(H,25,30) |
| InChIKey | PXOPCZFZWQUZNP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |