C21H19F3N4O3 — CID 46547192
N-[3-(oxolan-2-ylmethoxy)phenyl]-1-[2-(trifluoromethyl)phenyl]triazole-4-carboxamide (PubChem CID 46547192) has the molecular formula C21H19F3N4O3 and a molecular weight of 432.40 g/mol. Its IUPAC name is N-[3-(oxolan-2-ylmethoxy)phenyl]-1-[2-(trifluoromethyl)phenyl]triazole-4-carboxamide.
| Compound Name | N-[3-(oxolan-2-ylmethoxy)phenyl]-1-[2-(trifluoromethyl)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 46547192 |
| Molecular Formula | C21H19F3N4O3 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-[3-(oxolan-2-ylmethoxy)phenyl]-1-[2-(trifluoromethyl)phenyl]triazole-4-carboxamide |
| SMILES | O=C(Nc1cccc(OCC2CCCO2)c1)c1cn(-c2ccccc2C(F)(F)F)nn1 |
| InChI | InChI=1S/C21H19F3N4O3/c22-21(23,24)17-8-1-2-9-19(17)28-12-18(26-27-28)20(29)25-14-5-3-6-15(11-14)31-13-16-7-4-10-30-16/h1-3,5-6,8-9,11-12,16H,4,7,10,13H2,(H,25,29) |
| InChIKey | GIWKUCHNGAIHRY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |