C19H19N5O3 — CID 8895411
4-[[(2S)-oxolan-2-yl]methoxy]-N-[3-(tetrazol-1-yl)phenyl]benzamide (PubChem CID 8895411) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is 4-[[(2S)-oxolan-2-yl]methoxy]-N-[3-(tetrazol-1-yl)phenyl]benzamide.
| Compound Name | 4-[[(2S)-oxolan-2-yl]methoxy]-N-[3-(tetrazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 8895411 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 4-[[(2S)-oxolan-2-yl]methoxy]-N-[3-(tetrazol-1-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-n2cnnn2)c1)c1ccc(OC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C19H19N5O3/c25-19(21-15-3-1-4-16(11-15)24-13-20-22-23-24)14-6-8-17(9-7-14)27-12-18-5-2-10-26-18/h1,3-4,6-9,11,13,18H,2,5,10,12H2,(H,21,25)/t18-/m0/s1 |
| InChIKey | WORPGCVDDMZRJQ-SFHVURJKSA-N |
| XLogP | 2.47 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |