C24H29N3O4 — CID 55985629
1-[[3-[[4-(oxolan-2-ylmethoxy)benzoyl]amino]phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 55985629) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is 1-[[3-[[4-(oxolan-2-ylmethoxy)benzoyl]amino]phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[[3-[[4-(oxolan-2-ylmethoxy)benzoyl]amino]phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55985629 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 1-[[3-[[4-(oxolan-2-ylmethoxy)benzoyl]amino]phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CCCN1Cc1cccc(NC(=O)c2ccc(OCC3CCCO3)cc2)c1 |
| InChI | InChI=1S/C24H29N3O4/c25-23(28)22-7-2-12-27(22)15-17-4-1-5-19(14-17)26-24(29)18-8-10-20(11-9-18)31-16-21-6-3-13-30-21/h1,4-5,8-11,14,21-22H,2-3,6-7,12-13,15-16H2,(H2,25,28)(H,26,29) |
| InChIKey | VXNWPROBLXVKIO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |