C16H18N4O3 — CID 30831505
3-amino-N-[3-[[(2S)-oxolan-2-yl]methoxy]phenyl]pyrazine-2-carboxamide (PubChem CID 30831505) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is 3-amino-N-[3-[[(2S)-oxolan-2-yl]methoxy]phenyl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[3-[[(2S)-oxolan-2-yl]methoxy]phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 30831505 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 3-amino-N-[3-[[(2S)-oxolan-2-yl]methoxy]phenyl]pyrazine-2-carboxamide |
| SMILES | Nc1nccnc1C(=O)Nc1cccc(OC[C@@H]2CCCO2)c1 |
| InChI | InChI=1S/C16H18N4O3/c17-15-14(18-6-7-19-15)16(21)20-11-3-1-4-12(9-11)23-10-13-5-2-8-22-13/h1,3-4,6-7,9,13H,2,5,8,10H2,(H2,17,19)(H,20,21)/t13-/m0/s1 |
| InChIKey | RQVVNOYFNXYUIM-ZDUSSCGKSA-N |
| XLogP | 1.87 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |