C21H22F3NO4 — CID 46803189
N-[3-(oxolan-2-ylmethoxy)phenyl]-4-(2,2,2-trifluoroethoxymethyl)benzamide (PubChem CID 46803189) has the molecular formula C21H22F3NO4 and a molecular weight of 409.40 g/mol. Its IUPAC name is N-[3-(oxolan-2-ylmethoxy)phenyl]-4-(2,2,2-trifluoroethoxymethyl)benzamide.
| Compound Name | N-[3-(oxolan-2-ylmethoxy)phenyl]-4-(2,2,2-trifluoroethoxymethyl)benzamide |
|---|---|
| PubChem CID | 46803189 |
| Molecular Formula | C21H22F3NO4 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-[3-(oxolan-2-ylmethoxy)phenyl]-4-(2,2,2-trifluoroethoxymethyl)benzamide |
| SMILES | O=C(Nc1cccc(OCC2CCCO2)c1)c1ccc(COCC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H22F3NO4/c22-21(23,24)14-27-12-15-6-8-16(9-7-15)20(26)25-17-3-1-4-18(11-17)29-13-19-5-2-10-28-19/h1,3-4,6-9,11,19H,2,5,10,12-14H2,(H,25,26) |
| InChIKey | QIHCLFNMBLQMRE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |