C20H17BrF3N5O2 — CID 112819500
N-(5-bromo-2-morpholin-4-ylphenyl)-1-[2-(trifluoromethyl)phenyl]triazole-4-carboxamide (PubChem CID 112819500) has the molecular formula C20H17BrF3N5O2 and a molecular weight of 496.29 g/mol. Its IUPAC name is N-(5-bromo-2-morpholin-4-ylphenyl)-1-[2-(trifluoromethyl)phenyl]triazole-4-carboxamide.
| Compound Name | N-(5-bromo-2-morpholin-4-ylphenyl)-1-[2-(trifluoromethyl)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 112819500 |
| Molecular Formula | C20H17BrF3N5O2 |
| Molecular Weight | 496.29 g/mol |
| Exact Mass | 495.05 |
| IUPAC Name | N-(5-bromo-2-morpholin-4-ylphenyl)-1-[2-(trifluoromethyl)phenyl]triazole-4-carboxamide |
| SMILES | O=C(Nc1cc(Br)ccc1N1CCOCC1)c1cn(-c2ccccc2C(F)(F)F)nn1 |
| InChI | InChI=1S/C20H17BrF3N5O2/c21-13-5-6-18(28-7-9-31-10-8-28)15(11-13)25-19(30)16-12-29(27-26-16)17-4-2-1-3-14(17)20(22,23)24/h1-6,11-12H,7-10H2,(H,25,30) |
| InChIKey | XZYXDQBRXUGYJN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |