C16H17F3N4O3 — CID 119357117
4-methyl-4-[[1-[3-(trifluoromethyl)phenyl]triazole-4-carbonyl]amino]pentanoic acid (PubChem CID 119357117) has the molecular formula C16H17F3N4O3 and a molecular weight of 370.33 g/mol. Its IUPAC name is 4-methyl-4-[[1-[3-(trifluoromethyl)phenyl]triazole-4-carbonyl]amino]pentanoic acid.
| Compound Name | 4-methyl-4-[[1-[3-(trifluoromethyl)phenyl]triazole-4-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119357117 |
| Molecular Formula | C16H17F3N4O3 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 4-methyl-4-[[1-[3-(trifluoromethyl)phenyl]triazole-4-carbonyl]amino]pentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)c1cn(-c2cccc(C(F)(F)F)c2)nn1 |
| InChI | InChI=1S/C16H17F3N4O3/c1-15(2,7-6-13(24)25)20-14(26)12-9-23(22-21-12)11-5-3-4-10(8-11)16(17,18)19/h3-5,8-9H,6-7H2,1-2H3,(H,20,26)(H,24,25) |
| InChIKey | CCTRXVAQJLBTFP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |