C18H16F3N5O3S — CID 155950022
N-[ethyl(phenyl)sulfamoyl]-1-[3-(trifluoromethyl)phenyl]triazole-4-carboxamide (PubChem CID 155950022) has the molecular formula C18H16F3N5O3S and a molecular weight of 439.42 g/mol. Its IUPAC name is N-[ethyl(phenyl)sulfamoyl]-1-[3-(trifluoromethyl)phenyl]triazole-4-carboxamide.
| Compound Name | N-[ethyl(phenyl)sulfamoyl]-1-[3-(trifluoromethyl)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 155950022 |
| Molecular Formula | C18H16F3N5O3S |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | N-[ethyl(phenyl)sulfamoyl]-1-[3-(trifluoromethyl)phenyl]triazole-4-carboxamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)NC(=O)c1cn(-c2cccc(C(F)(F)F)c2)nn1 |
| InChI | InChI=1S/C18H16F3N5O3S/c1-2-26(14-8-4-3-5-9-14)30(28,29)23-17(27)16-12-25(24-22-16)15-10-6-7-13(11-15)18(19,20)21/h3-12H,2H2,1H3,(H,23,27) |
| InChIKey | JBIPHUDSCJYRQU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |