C16H15F3N4O3 — CID 120692776
(E)-2-[[1-[3-(trifluoromethyl)phenyl]triazole-4-carbonyl]amino]hex-4-enoic acid (PubChem CID 120692776) has the molecular formula C16H15F3N4O3 and a molecular weight of 368.32 g/mol. Its IUPAC name is (E)-2-[[1-[3-(trifluoromethyl)phenyl]triazole-4-carbonyl]amino]hex-4-enoic acid.
| Compound Name | (E)-2-[[1-[3-(trifluoromethyl)phenyl]triazole-4-carbonyl]amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120692776 |
| Molecular Formula | C16H15F3N4O3 |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | (E)-2-[[1-[3-(trifluoromethyl)phenyl]triazole-4-carbonyl]amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)c1cn(-c2cccc(C(F)(F)F)c2)nn1)C(=O)O |
| InChI | InChI=1S/C16H15F3N4O3/c1-2-3-7-12(15(25)26)20-14(24)13-9-23(22-21-13)11-6-4-5-10(8-11)16(17,18)19/h2-6,8-9,12H,7H2,1H3,(H,20,24)(H,25,26)/b3-2+ |
| InChIKey | HEJPHMBQIIDLEM-NSCUHMNNSA-N |
| XLogP | 2.44 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|