C17H20N4O3 — CID 120693785
(E)-2-[[5-methyl-1-(3-methylphenyl)triazole-4-carbonyl]amino]hex-4-enoic acid (PubChem CID 120693785) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is (E)-2-[[5-methyl-1-(3-methylphenyl)triazole-4-carbonyl]amino]hex-4-enoic acid.
| Compound Name | (E)-2-[[5-methyl-1-(3-methylphenyl)triazole-4-carbonyl]amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120693785 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (E)-2-[[5-methyl-1-(3-methylphenyl)triazole-4-carbonyl]amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)c1nnn(-c2cccc(C)c2)c1C)C(=O)O |
| InChI | InChI=1S/C17H20N4O3/c1-4-5-9-14(17(23)24)18-16(22)15-12(3)21(20-19-15)13-8-6-7-11(2)10-13/h4-8,10,14H,9H2,1-3H3,(H,18,22)(H,23,24)/b5-4+ |
| InChIKey | HFIPBSQLDFXUFX-SNAWJCMRSA-N |
| XLogP | 2.03 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|