C21H22N4O — CID 86952801
5-methyl-N-[(E)-pent-3-enyl]-1-(4-phenylphenyl)triazole-4-carboxamide (PubChem CID 86952801) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is 5-methyl-N-[(E)-pent-3-enyl]-1-(4-phenylphenyl)triazole-4-carboxamide.
| Compound Name | 5-methyl-N-[(E)-pent-3-enyl]-1-(4-phenylphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 86952801 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 5-methyl-N-[(E)-pent-3-enyl]-1-(4-phenylphenyl)triazole-4-carboxamide |
| SMILES | C/C=C/CCNC(=O)c1nnn(-c2ccc(-c3ccccc3)cc2)c1C |
| InChI | InChI=1S/C21H22N4O/c1-3-4-8-15-22-21(26)20-16(2)25(24-23-20)19-13-11-18(12-14-19)17-9-6-5-7-10-17/h3-7,9-14H,8,15H2,1-2H3,(H,22,26)/b4-3+ |
| InChIKey | SQKWXZGVARNJGJ-ONEGZZNKSA-N |
| XLogP | 3.94 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|