C25H23N5O3 — CID 60520886
5-methyl-1-(3-methylphenyl)-N'-[2-(2-phenylphenoxy)acetyl]triazole-4-carbohydrazide (PubChem CID 60520886) has the molecular formula C25H23N5O3 and a molecular weight of 441.49 g/mol. Its IUPAC name is 5-methyl-1-(3-methylphenyl)-N'-[2-(2-phenylphenoxy)acetyl]triazole-4-carbohydrazide.
| Compound Name | 5-methyl-1-(3-methylphenyl)-N'-[2-(2-phenylphenoxy)acetyl]triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 60520886 |
| Molecular Formula | C25H23N5O3 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 5-methyl-1-(3-methylphenyl)-N'-[2-(2-phenylphenoxy)acetyl]triazole-4-carbohydrazide |
| SMILES | Cc1cccc(-n2nnc(C(=O)NNC(=O)COc3ccccc3-c3ccccc3)c2C)c1 |
| InChI | InChI=1S/C25H23N5O3/c1-17-9-8-12-20(15-17)30-18(2)24(27-29-30)25(32)28-26-23(31)16-33-22-14-7-6-13-21(22)19-10-4-3-5-11-19/h3-15H,16H2,1-2H3,(H,26,31)(H,28,32) |
| InChIKey | SELCYAJPIKQJOF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|