C25H21N3O4 — CID 55644587
3-(4-methylphenyl)-N'-[2-(2-phenylphenoxy)acetyl]-1,2-oxazole-5-carbohydrazide (PubChem CID 55644587) has the molecular formula C25H21N3O4 and a molecular weight of 427.46 g/mol. Its IUPAC name is 3-(4-methylphenyl)-N'-[2-(2-phenylphenoxy)acetyl]-1,2-oxazole-5-carbohydrazide.
| Compound Name | 3-(4-methylphenyl)-N'-[2-(2-phenylphenoxy)acetyl]-1,2-oxazole-5-carbohydrazide |
|---|---|
| PubChem CID | 55644587 |
| Molecular Formula | C25H21N3O4 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 3-(4-methylphenyl)-N'-[2-(2-phenylphenoxy)acetyl]-1,2-oxazole-5-carbohydrazide |
| SMILES | Cc1ccc(-c2cc(C(=O)NNC(=O)COc3ccccc3-c3ccccc3)on2)cc1 |
| InChI | InChI=1S/C25H21N3O4/c1-17-11-13-19(14-12-17)21-15-23(32-28-21)25(30)27-26-24(29)16-31-22-10-6-5-9-20(22)18-7-3-2-4-8-18/h2-15H,16H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | AAFVDMUYFWVLTI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|