C19H18ClN5O2S — CID 60520668
N'-[2-(4-chlorophenyl)sulfanylacetyl]-5-methyl-1-(3-methylphenyl)triazole-4-carbohydrazide (PubChem CID 60520668) has the molecular formula C19H18ClN5O2S and a molecular weight of 415.91 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)sulfanylacetyl]-5-methyl-1-(3-methylphenyl)triazole-4-carbohydrazide.
| Compound Name | N'-[2-(4-chlorophenyl)sulfanylacetyl]-5-methyl-1-(3-methylphenyl)triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 60520668 |
| Molecular Formula | C19H18ClN5O2S |
| Molecular Weight | 415.91 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | N'-[2-(4-chlorophenyl)sulfanylacetyl]-5-methyl-1-(3-methylphenyl)triazole-4-carbohydrazide |
| SMILES | Cc1cccc(-n2nnc(C(=O)NNC(=O)CSc3ccc(Cl)cc3)c2C)c1 |
| InChI | InChI=1S/C19H18ClN5O2S/c1-12-4-3-5-15(10-12)25-13(2)18(22-24-25)19(27)23-21-17(26)11-28-16-8-6-14(20)7-9-16/h3-10H,11H2,1-2H3,(H,21,26)(H,23,27) |
| InChIKey | SOFFYDALFBROGD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.91 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|