C21H21Cl2N5O3 — CID 55883015
N'-[4-(2,4-dichlorophenoxy)butanoyl]-5-methyl-1-(4-methylphenyl)triazole-4-carbohydrazide (PubChem CID 55883015) has the molecular formula C21H21Cl2N5O3 and a molecular weight of 462.34 g/mol. Its IUPAC name is N'-[4-(2,4-dichlorophenoxy)butanoyl]-5-methyl-1-(4-methylphenyl)triazole-4-carbohydrazide.
| Compound Name | N'-[4-(2,4-dichlorophenoxy)butanoyl]-5-methyl-1-(4-methylphenyl)triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 55883015 |
| Molecular Formula | C21H21Cl2N5O3 |
| Molecular Weight | 462.34 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | N'-[4-(2,4-dichlorophenoxy)butanoyl]-5-methyl-1-(4-methylphenyl)triazole-4-carbohydrazide |
| SMILES | Cc1ccc(-n2nnc(C(=O)NNC(=O)CCCOc3ccc(Cl)cc3Cl)c2C)cc1 |
| InChI | InChI=1S/C21H21Cl2N5O3/c1-13-5-8-16(9-6-13)28-14(2)20(25-27-28)21(30)26-24-19(29)4-3-11-31-18-10-7-15(22)12-17(18)23/h5-10,12H,3-4,11H2,1-2H3,(H,24,29)(H,26,30) |
| InChIKey | OXEDPNDVXZONGA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|