C18H18Cl2N2O3S — CID 9404560
4-(2,4-dichlorophenoxy)-N'-[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]butanehydrazide (PubChem CID 9404560) has the molecular formula C18H18Cl2N2O3S and a molecular weight of 413.33 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N'-[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]butanehydrazide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N'-[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]butanehydrazide |
|---|---|
| PubChem CID | 9404560 |
| Molecular Formula | C18H18Cl2N2O3S |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N'-[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]butanehydrazide |
| SMILES | Cc1ccc(/C=C/C(=O)NNC(=O)CCCOc2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C18H18Cl2N2O3S/c1-12-4-6-14(26-12)7-9-18(24)22-21-17(23)3-2-10-25-16-8-5-13(19)11-15(16)20/h4-9,11H,2-3,10H2,1H3,(H,21,23)(H,22,24)/b9-7+ |
| InChIKey | PJLDXYZZAFOEAP-VQHVLOKHSA-N |
| XLogP | 4.38 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|