C25H25Cl2N3O6S — CID 4849820
5-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamoyl]-2-methoxy-N-(4-methylphenyl)benzenesulfonamide (PubChem CID 4849820) has the molecular formula C25H25Cl2N3O6S and a molecular weight of 566.46 g/mol. Its IUPAC name is 5-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamoyl]-2-methoxy-N-(4-methylphenyl)benzenesulfonamide.
| Compound Name | 5-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamoyl]-2-methoxy-N-(4-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 4849820 |
| Molecular Formula | C25H25Cl2N3O6S |
| Molecular Weight | 566.46 g/mol |
| Exact Mass | 565.08 |
| IUPAC Name | 5-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamoyl]-2-methoxy-N-(4-methylphenyl)benzenesulfonamide |
| SMILES | COc1ccc(C(=O)NNC(=O)CCCOc2ccc(Cl)cc2Cl)cc1S(=O)(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C25H25Cl2N3O6S/c1-16-5-9-19(10-6-16)30-37(33,34)23-14-17(7-11-22(23)35-2)25(32)29-28-24(31)4-3-13-36-21-12-8-18(26)15-20(21)27/h5-12,14-15,30H,3-4,13H2,1-2H3,(H,28,31)(H,29,32) |
| InChIKey | WKBCOGVKKSFLNY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|