C22H22N4O3S — CID 55350702
N'-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]-2-(2-phenylphenoxy)acetohydrazide (PubChem CID 55350702) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is N'-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]-2-(2-phenylphenoxy)acetohydrazide.
| Compound Name | N'-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]-2-(2-phenylphenoxy)acetohydrazide |
|---|---|
| PubChem CID | 55350702 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N'-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]-2-(2-phenylphenoxy)acetohydrazide |
| SMILES | Cc1cc(C)nc(SCC(=O)NNC(=O)COc2ccccc2-c2ccccc2)n1 |
| InChI | InChI=1S/C22H22N4O3S/c1-15-12-16(2)24-22(23-15)30-14-21(28)26-25-20(27)13-29-19-11-7-6-10-18(19)17-8-4-3-5-9-17/h3-12H,13-14H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | GFPASQHMFHYAPI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|