C24H23N5O4S — CID 4790941
N'-[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-(2-phenylphenoxy)acetohydrazide (PubChem CID 4790941) has the molecular formula C24H23N5O4S and a molecular weight of 477.55 g/mol. Its IUPAC name is N'-[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-(2-phenylphenoxy)acetohydrazide.
| Compound Name | N'-[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-(2-phenylphenoxy)acetohydrazide |
|---|---|
| PubChem CID | 4790941 |
| Molecular Formula | C24H23N5O4S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | N'-[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-(2-phenylphenoxy)acetohydrazide |
| SMILES | CCn1c(SCC(=O)NNC(=O)COc2ccccc2-c2ccccc2)nnc1-c1ccco1 |
| InChI | InChI=1S/C24H23N5O4S/c1-2-29-23(20-13-8-14-32-20)27-28-24(29)34-16-22(31)26-25-21(30)15-33-19-12-7-6-11-18(19)17-9-4-3-5-10-17/h3-14H,2,15-16H2,1H3,(H,25,30)(H,26,31) |
| InChIKey | ZNIKNCJXIJFVIL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 111.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|