C20H21N7O3S — CID 4789700
N'-[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-(1-methylbenzimidazol-2-yl)acetohydrazide (PubChem CID 4789700) has the molecular formula C20H21N7O3S and a molecular weight of 439.50 g/mol. Its IUPAC name is N'-[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-(1-methylbenzimidazol-2-yl)acetohydrazide.
| Compound Name | N'-[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-(1-methylbenzimidazol-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 4789700 |
| Molecular Formula | C20H21N7O3S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | N'-[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-(1-methylbenzimidazol-2-yl)acetohydrazide |
| SMILES | CCn1c(SCC(=O)NNC(=O)Cc2nc3ccccc3n2C)nnc1-c1ccco1 |
| InChI | InChI=1S/C20H21N7O3S/c1-3-27-19(15-9-6-10-30-15)24-25-20(27)31-12-18(29)23-22-17(28)11-16-21-13-7-4-5-8-14(13)26(16)2/h4-10H,3,11-12H2,1-2H3,(H,22,28)(H,23,29) |
| InChIKey | XTBGJOSBSOVYTD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 119.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|