C18H18N6O6S — CID 34060706
N'-[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-(2-nitrophenoxy)acetohydrazide (PubChem CID 34060706) has the molecular formula C18H18N6O6S and a molecular weight of 446.45 g/mol. Its IUPAC name is N'-[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-(2-nitrophenoxy)acetohydrazide.
| Compound Name | N'-[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-(2-nitrophenoxy)acetohydrazide |
|---|---|
| PubChem CID | 34060706 |
| Molecular Formula | C18H18N6O6S |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | N'-[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-(2-nitrophenoxy)acetohydrazide |
| SMILES | CCn1c(SCC(=O)NNC(=O)COc2ccccc2[N+](=O)[O-])nnc1-c1ccco1 |
| InChI | InChI=1S/C18H18N6O6S/c1-2-23-17(14-8-5-9-29-14)21-22-18(23)31-11-16(26)20-19-15(25)10-30-13-7-4-3-6-12(13)24(27)28/h3-9H,2,10-11H2,1H3,(H,19,25)(H,20,26) |
| InChIKey | MSOFGRVHVCMYJJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|