C19H19N5O6S — CID 3464337
[2-(4-methyl-2-nitroanilino)-2-oxoethyl] 2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 3464337) has the molecular formula C19H19N5O6S and a molecular weight of 445.46 g/mol. Its IUPAC name is [2-(4-methyl-2-nitroanilino)-2-oxoethyl] 2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | [2-(4-methyl-2-nitroanilino)-2-oxoethyl] 2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 3464337 |
| Molecular Formula | C19H19N5O6S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | [2-(4-methyl-2-nitroanilino)-2-oxoethyl] 2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | CCn1c(SCC(=O)OCC(=O)Nc2ccc(C)cc2[N+](=O)[O-])nnc1-c1ccco1 |
| InChI | InChI=1S/C19H19N5O6S/c1-3-23-18(15-5-4-8-29-15)21-22-19(23)31-11-17(26)30-10-16(25)20-13-7-6-12(2)9-14(13)24(27)28/h4-9H,3,10-11H2,1-2H3,(H,20,25) |
| InChIKey | OGHUYHWKTUDHSH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|