C15H20N4O5S — CID 7738005
[2-(2-methoxyethylamino)-2-oxoethyl] 2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 7738005) has the molecular formula C15H20N4O5S and a molecular weight of 368.42 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxoethyl] 2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | [2-(2-methoxyethylamino)-2-oxoethyl] 2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 7738005 |
| Molecular Formula | C15H20N4O5S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxoethyl] 2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | CCn1c(SCC(=O)OCC(=O)NCCOC)nnc1-c1ccco1 |
| InChI | InChI=1S/C15H20N4O5S/c1-3-19-14(11-5-4-7-23-11)17-18-15(19)25-10-13(21)24-9-12(20)16-6-8-22-2/h4-5,7H,3,6,8-10H2,1-2H3,(H,16,20) |
| InChIKey | KLRXKNCURWLUKQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|