C15H15ClN4O2S — CID 51140256
2-chloro-N'-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]benzohydrazide (PubChem CID 51140256) has the molecular formula C15H15ClN4O2S and a molecular weight of 350.83 g/mol. Its IUPAC name is 2-chloro-N'-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]benzohydrazide.
| Compound Name | 2-chloro-N'-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]benzohydrazide |
|---|---|
| PubChem CID | 51140256 |
| Molecular Formula | C15H15ClN4O2S |
| Molecular Weight | 350.83 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 2-chloro-N'-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]benzohydrazide |
| SMILES | Cc1cc(C)nc(SCC(=O)NNC(=O)c2ccccc2Cl)n1 |
| InChI | InChI=1S/C15H15ClN4O2S/c1-9-7-10(2)18-15(17-9)23-8-13(21)19-20-14(22)11-5-3-4-6-12(11)16/h3-7H,8H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | PAAUUAGJHFUZDN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.83 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|