C19H16ClN3OS — CID 30257491
2-chloro-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]benzamide (PubChem CID 30257491) has the molecular formula C19H16ClN3OS and a molecular weight of 369.88 g/mol. Its IUPAC name is 2-chloro-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]benzamide.
| Compound Name | 2-chloro-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 30257491 |
| Molecular Formula | C19H16ClN3OS |
| Molecular Weight | 369.88 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 2-chloro-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]benzamide |
| SMILES | Cc1cc(C)nc(Sc2ccc(NC(=O)c3ccccc3Cl)cc2)n1 |
| InChI | InChI=1S/C19H16ClN3OS/c1-12-11-13(2)22-19(21-12)25-15-9-7-14(8-10-15)23-18(24)16-5-3-4-6-17(16)20/h3-11H,1-2H3,(H,23,24) |
| InChIKey | HLZICSFNMGNGGK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.88 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |