C19H16FN3OS — CID 24591939
N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-4-fluorobenzamide (PubChem CID 24591939) has the molecular formula C19H16FN3OS and a molecular weight of 353.42 g/mol. Its IUPAC name is N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-4-fluorobenzamide.
| Compound Name | N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 24591939 |
| Molecular Formula | C19H16FN3OS |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-4-fluorobenzamide |
| SMILES | Cc1cc(C)nc(Sc2ccc(NC(=O)c3ccc(F)cc3)cc2)n1 |
| InChI | InChI=1S/C19H16FN3OS/c1-12-11-13(2)22-19(21-12)25-17-9-7-16(8-10-17)23-18(24)14-3-5-15(20)6-4-14/h3-11H,1-2H3,(H,23,24) |
| InChIKey | ITYMKAQYJVODNN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |