C16H15Cl2N3OS — CID 24677204
2,2-dichloro-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]cyclopropane-1-carboxamide (PubChem CID 24677204) has the molecular formula C16H15Cl2N3OS and a molecular weight of 368.29 g/mol. Its IUPAC name is 2,2-dichloro-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 24677204 |
| Molecular Formula | C16H15Cl2N3OS |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 2,2-dichloro-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]cyclopropane-1-carboxamide |
| SMILES | Cc1cc(C)nc(Sc2ccc(NC(=O)C3CC3(Cl)Cl)cc2)n1 |
| InChI | InChI=1S/C16H15Cl2N3OS/c1-9-7-10(2)20-15(19-9)23-12-5-3-11(4-6-12)21-14(22)13-8-16(13,17)18/h3-7,13H,8H2,1-2H3,(H,21,22) |
| InChIKey | QUKWSTGEARUOFE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|