C22H19ClN2O2S — CID 9339375
N'-(2-benzhydrylsulfanylacetyl)-2-chlorobenzohydrazide (PubChem CID 9339375) has the molecular formula C22H19ClN2O2S and a molecular weight of 410.93 g/mol. Its IUPAC name is N'-(2-benzhydrylsulfanylacetyl)-2-chlorobenzohydrazide.
| Compound Name | N'-(2-benzhydrylsulfanylacetyl)-2-chlorobenzohydrazide |
|---|---|
| PubChem CID | 9339375 |
| Molecular Formula | C22H19ClN2O2S |
| Molecular Weight | 410.93 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | N'-(2-benzhydrylsulfanylacetyl)-2-chlorobenzohydrazide |
| SMILES | O=C(CSC(c1ccccc1)c1ccccc1)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C22H19ClN2O2S/c23-19-14-8-7-13-18(19)22(27)25-24-20(26)15-28-21(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-14,21H,15H2,(H,24,26)(H,25,27) |
| InChIKey | DALTXWQHEUTSNR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.93 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|