C20H22ClN3O3S — CID 135680055
2-[2-[2-[(S)-(4-chlorophenyl)-phenylmethyl]sulfanylacetyl]hydrazinyl]-2-oxo-N-propan-2-ylacetamide (PubChem CID 135680055) has the molecular formula C20H22ClN3O3S and a molecular weight of 419.93 g/mol. Its IUPAC name is 2-[2-[2-[(S)-(4-chlorophenyl)-phenylmethyl]sulfanylacetyl]hydrazinyl]-2-oxo-N-propan-2-ylacetamide.
| Compound Name | 2-[2-[2-[(S)-(4-chlorophenyl)-phenylmethyl]sulfanylacetyl]hydrazinyl]-2-oxo-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 135680055 |
| Molecular Formula | C20H22ClN3O3S |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 2-[2-[2-[(S)-(4-chlorophenyl)-phenylmethyl]sulfanylacetyl]hydrazinyl]-2-oxo-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)C(=O)NNC(=O)CS[C@@H](c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H22ClN3O3S/c1-13(2)22-19(26)20(27)24-23-17(25)12-28-18(14-6-4-3-5-7-14)15-8-10-16(21)11-9-15/h3-11,13,18H,12H2,1-2H3,(H,22,26)(H,23,25)(H,24,27)/t18-/m0/s1 |
| InChIKey | GOFGWIPOAQRGJR-SFHVURJKSA-N |
| XLogP | 2.83 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|