C22H27ClN2O2S — CID 97077393
N-[3-[[2-[(R)-(4-chlorophenyl)-phenylmethyl]sulfanylacetyl]amino]propyl]-2-methylpropanamide (PubChem CID 97077393) has the molecular formula C22H27ClN2O2S and a molecular weight of 418.99 g/mol. Its IUPAC name is N-[3-[[2-[(R)-(4-chlorophenyl)-phenylmethyl]sulfanylacetyl]amino]propyl]-2-methylpropanamide.
| Compound Name | N-[3-[[2-[(R)-(4-chlorophenyl)-phenylmethyl]sulfanylacetyl]amino]propyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 97077393 |
| Molecular Formula | C22H27ClN2O2S |
| Molecular Weight | 418.99 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | N-[3-[[2-[(R)-(4-chlorophenyl)-phenylmethyl]sulfanylacetyl]amino]propyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCCCNC(=O)CS[C@H](c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H27ClN2O2S/c1-16(2)22(27)25-14-6-13-24-20(26)15-28-21(17-7-4-3-5-8-17)18-9-11-19(23)12-10-18/h3-5,7-12,16,21H,6,13-15H2,1-2H3,(H,24,26)(H,25,27)/t21-/m1/s1 |
| InChIKey | JZKIYCPWDBAOTP-OAQYLSRUSA-N |
| XLogP | 4.44 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.99 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|