C20H18ClNO2S — CID 47003849
2-[(4-chlorophenyl)-phenylmethyl]sulfanyl-N-(furan-2-ylmethyl)acetamide (PubChem CID 47003849) has the molecular formula C20H18ClNO2S and a molecular weight of 371.89 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)-phenylmethyl]sulfanyl-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[(4-chlorophenyl)-phenylmethyl]sulfanyl-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 47003849 |
| Molecular Formula | C20H18ClNO2S |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 2-[(4-chlorophenyl)-phenylmethyl]sulfanyl-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(CSC(c1ccccc1)c1ccc(Cl)cc1)NCc1ccco1 |
| InChI | InChI=1S/C20H18ClNO2S/c21-17-10-8-16(9-11-17)20(15-5-2-1-3-6-15)25-14-19(23)22-13-18-7-4-12-24-18/h1-12,20H,13-14H2,(H,22,23) |
| InChIKey | WKSSXPAMLKSLTL-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |