C17H15ClN2O4S — CID 4805905
2-chloro-N'-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)acetyl]benzohydrazide (PubChem CID 4805905) has the molecular formula C17H15ClN2O4S and a molecular weight of 378.84 g/mol. Its IUPAC name is 2-chloro-N'-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)acetyl]benzohydrazide.
| Compound Name | 2-chloro-N'-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 4805905 |
| Molecular Formula | C17H15ClN2O4S |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 2-chloro-N'-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)acetyl]benzohydrazide |
| SMILES | O=C(CSc1ccc2c(c1)OCCO2)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C17H15ClN2O4S/c18-13-4-2-1-3-12(13)17(22)20-19-16(21)10-25-11-5-6-14-15(9-11)24-8-7-23-14/h1-6,9H,7-8,10H2,(H,19,21)(H,20,22) |
| InChIKey | DQHAEPPLFLPBNG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|