C18H20N2O4S2 — CID 9418304
N'-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)acetyl]-5-ethyl-4-methylthiophene-2-carbohydrazide (PubChem CID 9418304) has the molecular formula C18H20N2O4S2 and a molecular weight of 392.50 g/mol. Its IUPAC name is N'-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)acetyl]-5-ethyl-4-methylthiophene-2-carbohydrazide.
| Compound Name | N'-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)acetyl]-5-ethyl-4-methylthiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 9418304 |
| Molecular Formula | C18H20N2O4S2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | N'-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)acetyl]-5-ethyl-4-methylthiophene-2-carbohydrazide |
| SMILES | CCc1sc(C(=O)NNC(=O)CSc2ccc3c(c2)OCCO3)cc1C |
| InChI | InChI=1S/C18H20N2O4S2/c1-3-15-11(2)8-16(26-15)18(22)20-19-17(21)10-25-12-4-5-13-14(9-12)24-7-6-23-13/h4-5,8-9H,3,6-7,10H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | WYGACKKPUDXWIZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|