C20H18N4O4S — CID 7907286
N'-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)acetyl]-3-phenyl-1H-pyrazole-5-carbohydrazide (PubChem CID 7907286) has the molecular formula C20H18N4O4S and a molecular weight of 410.46 g/mol. Its IUPAC name is N'-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)acetyl]-3-phenyl-1H-pyrazole-5-carbohydrazide.
| Compound Name | N'-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)acetyl]-3-phenyl-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 7907286 |
| Molecular Formula | C20H18N4O4S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | N'-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)acetyl]-3-phenyl-1H-pyrazole-5-carbohydrazide |
| SMILES | O=C(CSc1ccc2c(c1)OCCO2)NNC(=O)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C20H18N4O4S/c25-19(12-29-14-6-7-17-18(10-14)28-9-8-27-17)23-24-20(26)16-11-15(21-22-16)13-4-2-1-3-5-13/h1-7,10-11H,8-9,12H2,(H,21,22)(H,23,25)(H,24,26) |
| InChIKey | HYNFSYKSMMEQBZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|