C18H17FN2O5S — CID 7809043
N'-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)acetyl]-2-(2-fluorophenoxy)acetohydrazide (PubChem CID 7809043) has the molecular formula C18H17FN2O5S and a molecular weight of 392.41 g/mol. Its IUPAC name is N'-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)acetyl]-2-(2-fluorophenoxy)acetohydrazide.
| Compound Name | N'-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)acetyl]-2-(2-fluorophenoxy)acetohydrazide |
|---|---|
| PubChem CID | 7809043 |
| Molecular Formula | C18H17FN2O5S |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | N'-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)acetyl]-2-(2-fluorophenoxy)acetohydrazide |
| SMILES | O=C(COc1ccccc1F)NNC(=O)CSc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H17FN2O5S/c19-13-3-1-2-4-14(13)26-10-17(22)20-21-18(23)11-27-12-5-6-15-16(9-12)25-8-7-24-15/h1-6,9H,7-8,10-11H2,(H,20,22)(H,21,23) |
| InChIKey | KYDNCPMWLJXJEX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|