C25H21N3O5S — CID 24636238
2-[4-(4-cyanophenyl)phenoxy]-N'-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)acetyl]acetohydrazide (PubChem CID 24636238) has the molecular formula C25H21N3O5S and a molecular weight of 475.53 g/mol. Its IUPAC name is 2-[4-(4-cyanophenyl)phenoxy]-N'-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)acetyl]acetohydrazide.
| Compound Name | 2-[4-(4-cyanophenyl)phenoxy]-N'-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 24636238 |
| Molecular Formula | C25H21N3O5S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 2-[4-(4-cyanophenyl)phenoxy]-N'-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)acetyl]acetohydrazide |
| SMILES | N#Cc1ccc(-c2ccc(OCC(=O)NNC(=O)CSc3ccc4c(c3)OCCO4)cc2)cc1 |
| InChI | InChI=1S/C25H21N3O5S/c26-14-17-1-3-18(4-2-17)19-5-7-20(8-6-19)33-15-24(29)27-28-25(30)16-34-21-9-10-22-23(13-21)32-12-11-31-22/h1-10,13H,11-12,15-16H2,(H,27,29)(H,28,30) |
| InChIKey | VKORADKMXFZOIL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|