C16H23N3O4S — CID 9418515
5-ethyl-4-methyl-N'-(4-morpholin-4-yl-4-oxobutanoyl)thiophene-2-carbohydrazide (PubChem CID 9418515) has the molecular formula C16H23N3O4S and a molecular weight of 353.44 g/mol. Its IUPAC name is 5-ethyl-4-methyl-N'-(4-morpholin-4-yl-4-oxobutanoyl)thiophene-2-carbohydrazide.
| Compound Name | 5-ethyl-4-methyl-N'-(4-morpholin-4-yl-4-oxobutanoyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 9418515 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 5-ethyl-4-methyl-N'-(4-morpholin-4-yl-4-oxobutanoyl)thiophene-2-carbohydrazide |
| SMILES | CCc1sc(C(=O)NNC(=O)CCC(=O)N2CCOCC2)cc1C |
| InChI | InChI=1S/C16H23N3O4S/c1-3-12-11(2)10-13(24-12)16(22)18-17-14(20)4-5-15(21)19-6-8-23-9-7-19/h10H,3-9H2,1-2H3,(H,17,20)(H,18,22) |
| InChIKey | DWRPHZNJURBALL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|