C16H18N2O3S2 — CID 4793750
5-ethyl-4-methyl-N'-(4-oxo-4-thiophen-2-ylbutanoyl)thiophene-2-carbohydrazide (PubChem CID 4793750) has the molecular formula C16H18N2O3S2 and a molecular weight of 350.47 g/mol. Its IUPAC name is 5-ethyl-4-methyl-N'-(4-oxo-4-thiophen-2-ylbutanoyl)thiophene-2-carbohydrazide.
| Compound Name | 5-ethyl-4-methyl-N'-(4-oxo-4-thiophen-2-ylbutanoyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 4793750 |
| Molecular Formula | C16H18N2O3S2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 5-ethyl-4-methyl-N'-(4-oxo-4-thiophen-2-ylbutanoyl)thiophene-2-carbohydrazide |
| SMILES | CCc1sc(C(=O)NNC(=O)CCC(=O)c2cccs2)cc1C |
| InChI | InChI=1S/C16H18N2O3S2/c1-3-12-10(2)9-14(23-12)16(21)18-17-15(20)7-6-11(19)13-5-4-8-22-13/h4-5,8-9H,3,6-7H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | MUBLEGBMXKPVMP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|