C18H19N3O3S2 — CID 25468869
5-ethyl-4-methyl-N'-[2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetyl]thiophene-2-carbohydrazide (PubChem CID 25468869) has the molecular formula C18H19N3O3S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 5-ethyl-4-methyl-N'-[2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetyl]thiophene-2-carbohydrazide.
| Compound Name | 5-ethyl-4-methyl-N'-[2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 25468869 |
| Molecular Formula | C18H19N3O3S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 5-ethyl-4-methyl-N'-[2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetyl]thiophene-2-carbohydrazide |
| SMILES | CCc1sc(C(=O)NNC(=O)Cc2nc(-c3cccs3)oc2C)cc1C |
| InChI | InChI=1S/C18H19N3O3S2/c1-4-13-10(2)8-15(26-13)17(23)21-20-16(22)9-12-11(3)24-18(19-12)14-6-5-7-25-14/h5-8H,4,9H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | SHWDJLXNFBPUSK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|