C21H23N3O5S — CID 46514440
3-methoxy-N'-[2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetyl]-4-propan-2-yloxybenzohydrazide (PubChem CID 46514440) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is 3-methoxy-N'-[2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetyl]-4-propan-2-yloxybenzohydrazide.
| Compound Name | 3-methoxy-N'-[2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetyl]-4-propan-2-yloxybenzohydrazide |
|---|---|
| PubChem CID | 46514440 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 3-methoxy-N'-[2-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)acetyl]-4-propan-2-yloxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)Cc2nc(-c3cccs3)oc2C)ccc1OC(C)C |
| InChI | InChI=1S/C21H23N3O5S/c1-12(2)28-16-8-7-14(10-17(16)27-4)20(26)24-23-19(25)11-15-13(3)29-21(22-15)18-6-5-9-30-18/h5-10,12H,11H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | HBJFHSMJZVXBKQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|