C17H18N2O4S — CID 18287127
N'-[4-(2-methoxy-5-methylphenyl)-4-oxobutanoyl]thiophene-2-carbohydrazide (PubChem CID 18287127) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is N'-[4-(2-methoxy-5-methylphenyl)-4-oxobutanoyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[4-(2-methoxy-5-methylphenyl)-4-oxobutanoyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 18287127 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | N'-[4-(2-methoxy-5-methylphenyl)-4-oxobutanoyl]thiophene-2-carbohydrazide |
| SMILES | COc1ccc(C)cc1C(=O)CCC(=O)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C17H18N2O4S/c1-11-5-7-14(23-2)12(10-11)13(20)6-8-16(21)18-19-17(22)15-4-3-9-24-15/h3-5,7,9-10H,6,8H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | ZXPFIAGLKOASBT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|