C19H26N4O3S2 — CID 9278398
4-ethyl-N'-[2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetyl]-5-propylthiophene-2-carbohydrazide (PubChem CID 9278398) has the molecular formula C19H26N4O3S2 and a molecular weight of 422.58 g/mol. Its IUPAC name is 4-ethyl-N'-[2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetyl]-5-propylthiophene-2-carbohydrazide.
| Compound Name | 4-ethyl-N'-[2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetyl]-5-propylthiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 9278398 |
| Molecular Formula | C19H26N4O3S2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 4-ethyl-N'-[2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetyl]-5-propylthiophene-2-carbohydrazide |
| SMILES | CCCc1sc(C(=O)NNC(=O)Cc2csc(N3CCOCC3)n2)cc1CC |
| InChI | InChI=1S/C19H26N4O3S2/c1-3-5-15-13(4-2)10-16(28-15)18(25)22-21-17(24)11-14-12-27-19(20-14)23-6-8-26-9-7-23/h10,12H,3-9,11H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | HDOYFXMOSOTNLQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|