C19H20N6O3S — CID 9278448
N'-[2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetyl]-1-phenylpyrazole-4-carbohydrazide (PubChem CID 9278448) has the molecular formula C19H20N6O3S and a molecular weight of 412.48 g/mol. Its IUPAC name is N'-[2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetyl]-1-phenylpyrazole-4-carbohydrazide.
| Compound Name | N'-[2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetyl]-1-phenylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 9278448 |
| Molecular Formula | C19H20N6O3S |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N'-[2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetyl]-1-phenylpyrazole-4-carbohydrazide |
| SMILES | O=C(Cc1csc(N2CCOCC2)n1)NNC(=O)c1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C19H20N6O3S/c26-17(10-15-13-29-19(21-15)24-6-8-28-9-7-24)22-23-18(27)14-11-20-25(12-14)16-4-2-1-3-5-16/h1-5,11-13H,6-10H2,(H,22,26)(H,23,27) |
| InChIKey | PYVWOVPNRSNGSG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|