C25H24N6O3S — CID 46656625
N'-[1-(4-methylphenyl)-3-phenylpyrazole-4-carbonyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide (PubChem CID 46656625) has the molecular formula C25H24N6O3S and a molecular weight of 488.57 g/mol. Its IUPAC name is N'-[1-(4-methylphenyl)-3-phenylpyrazole-4-carbonyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-[1-(4-methylphenyl)-3-phenylpyrazole-4-carbonyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 46656625 |
| Molecular Formula | C25H24N6O3S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | N'-[1-(4-methylphenyl)-3-phenylpyrazole-4-carbonyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide |
| SMILES | Cc1ccc(-n2cc(C(=O)NNC(=O)c3csc(N4CCOCC4)n3)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C25H24N6O3S/c1-17-7-9-19(10-8-17)31-15-20(22(29-31)18-5-3-2-4-6-18)23(32)27-28-24(33)21-16-35-25(26-21)30-11-13-34-14-12-30/h2-10,15-16H,11-14H2,1H3,(H,27,32)(H,28,33) |
| InChIKey | UTAXOHANVYVVQC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|