C19H24N4O3S — CID 41452787
N'-[3-(2,4-dimethylphenyl)propanoyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide (PubChem CID 41452787) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is N'-[3-(2,4-dimethylphenyl)propanoyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-[3-(2,4-dimethylphenyl)propanoyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 41452787 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N'-[3-(2,4-dimethylphenyl)propanoyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide |
| SMILES | Cc1ccc(CCC(=O)NNC(=O)c2csc(N3CCOCC3)n2)c(C)c1 |
| InChI | InChI=1S/C19H24N4O3S/c1-13-3-4-15(14(2)11-13)5-6-17(24)21-22-18(25)16-12-27-19(20-16)23-7-9-26-10-8-23/h3-4,11-12H,5-10H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | COFSGJZIDHTCEG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|