C22H25ClN6O3S — CID 55788860
N'-[2-[1-(3-chloro-4-methylphenyl)-3,5-dimethylpyrazol-4-yl]acetyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide (PubChem CID 55788860) has the molecular formula C22H25ClN6O3S and a molecular weight of 489.00 g/mol. Its IUPAC name is N'-[2-[1-(3-chloro-4-methylphenyl)-3,5-dimethylpyrazol-4-yl]acetyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-[2-[1-(3-chloro-4-methylphenyl)-3,5-dimethylpyrazol-4-yl]acetyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 55788860 |
| Molecular Formula | C22H25ClN6O3S |
| Molecular Weight | 489.00 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | N'-[2-[1-(3-chloro-4-methylphenyl)-3,5-dimethylpyrazol-4-yl]acetyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide |
| SMILES | Cc1ccc(-n2nc(C)c(CC(=O)NNC(=O)c3csc(N4CCOCC4)n3)c2C)cc1Cl |
| InChI | InChI=1S/C22H25ClN6O3S/c1-13-4-5-16(10-18(13)23)29-15(3)17(14(2)27-29)11-20(30)25-26-21(31)19-12-33-22(24-19)28-6-8-32-9-7-28/h4-5,10,12H,6-9,11H2,1-3H3,(H,25,30)(H,26,31) |
| InChIKey | YCYQXSLOSLWQQQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.00 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|