C23H33ClN4O2 — CID 55793924
2-[1-(3-chloro-4-methylphenyl)-3,5-dimethylpyrazol-4-yl]-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]acetamide (PubChem CID 55793924) has the molecular formula C23H33ClN4O2 and a molecular weight of 433.00 g/mol. Its IUPAC name is 2-[1-(3-chloro-4-methylphenyl)-3,5-dimethylpyrazol-4-yl]-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]acetamide.
| Compound Name | 2-[1-(3-chloro-4-methylphenyl)-3,5-dimethylpyrazol-4-yl]-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]acetamide |
|---|---|
| PubChem CID | 55793924 |
| Molecular Formula | C23H33ClN4O2 |
| Molecular Weight | 433.00 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 2-[1-(3-chloro-4-methylphenyl)-3,5-dimethylpyrazol-4-yl]-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]acetamide |
| SMILES | Cc1ccc(-n2nc(C)c(CC(=O)NCCCN3CC(C)OC(C)C3)c2C)cc1Cl |
| InChI | InChI=1S/C23H33ClN4O2/c1-15-7-8-20(11-22(15)24)28-19(5)21(18(4)26-28)12-23(29)25-9-6-10-27-13-16(2)30-17(3)14-27/h7-8,11,16-17H,6,9-10,12-14H2,1-5H3,(H,25,29) |
| InChIKey | GGISNATVWSWJOH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.00 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|